Font size
WorksheetsOption B Quiz
Total questions: 14
Worksheet time: 22mins
The formulas of three fatty acids are shown below:
stearic acid: CH3(CH2)16COOH
oleic acid: CH3(CH2)7CH=CH(CH2)7COOH
linoleic acid: CH3(CH2)4(CH=CHCH2)2(CH2)6COOH
Identify which of these fatty acids is monounsaturated. [1 mark]
(a)
The formulas of three fatty acids are shown below:
stearic acid: CH3(CH2)16COOH
oleic acid: CH3(CH2)7CH=CH(CH2)7COOH
linoleic acid: CH3(CH2)4(CH=CHCH2)2(CH2)6COOH
Explain which of the fatty acids has the highest melting point. [2 marks]
The structure of vitamin D is shown below.
Explain why vitamin D is a fat-soluble vitamin, even though it contains a polar hydroxyl (-OH) group. [1 mark]
Proteins are polymers made from amino acid monomers.
a. i. Identify the two functional groups responsible for the amphoteric property of all amino acids. [1 mark]
(a)
Glycine can exist in three different structures at equilibrium in aqueous solution.
Identify which of these ions is the zwitterion and identify which one occurs in greatest concentration at high pH. [2 marks]
(a)
Determine the number of water molecules that were formed in the formation of this polypeptide. [1 mark]
1
2
3
0
Identify the three amino acids used to make this polypeptide, using section 33 of the data booklet. [1 mark]
HL:
A mixture of serine and alanine is analysed by chromatography, using ethanol as the solvent.
State and explain which amino acid travelled the furthest.
[2 marks]
Photosynthesis is the process for the synthesis of glucose by producers.
State a balanced chemical equation for the overall reaction for photosynthesis. [1 mark]
(a)
A glucose monomer can polymerise to form starch, cellulose or glycogen.
Predict which of the three glucose polymers would have the lowest solubility in water. [1 mark]
(a)
Which carbon atom on the pentose sugar does the phosphate group bond to when nucleotides condense together to form phosphodiester bonds? [1 mark]
C1
C5
C2
C3
Nucleotides consist of a phosphate group bonded to a pentose sugar bonded to a nitrogenous base. How many different nucleotides exist naturally? [1 mark]
8
16
4
64
What are histones? [1 mark]
proteins
lipids
carbohydrates
hormones
HL
Two benefits of GM foods are that it can enhance their flavour, texture and nutritional value and also increase their resistance to disease.
Two concerns about the use of GM foods are that not enough is known about how genes operate, so there may be unforeseen consequences, and genetically modified genes may escape to contaminate normal crops.
State two more different potential benefits and two more different concerns about the use of genetically modified foods. [4 marks]
