Worksheets11SCIAB TERM 3 MCQ AY 24-25
Total questions: 80
Worksheet time: 1hrs 3mins
The graphs illustrate trends in four physical properties of elements in Period 3, excluding argon. Show the graph with electronegativity on the y-axis. (Na, Mg, Al, Si, P, S, Cl)
During a science project, Feli and Spring were discussing different types of solids. Feli mentioned that sulfur is an example of a solid that has a simple molecular lattice. Which solid are they referring to?
calcium fluoride
sulfur
silicon(IV) oxide
nickel
During a chemistry experiment, Bryant discovered that a certain semi-conductor, Q, when combined with water, produced white fumes and an acidic solution. Can you identify which Period 3 element Q is?
magnesium
aluminium
silicon
phosphorus
Winston and Kath are conducting an experiment in their chemistry lab. Elements X and Y are in Period 3 of the Periodic Table. Element X is either phosphorus or sulfur, while Element Y is either sodium or magnesium. During their experiment, Element X forms an oxide that reacts with water to produce a solution containing the aqueous anion XO42–. They discover that one mole of Element Y reacts with one mole of chlorine molecules. By the end of the reaction, all of Element Y and all of the chlorine molecules have been completely consumed. Can you help Winston and Kath identify elements X and Y?
Hillary and Kiven are studying the first eight successive ionisation energies for two elements of Period 3 of the Periodic Table. They are curious about the formula of the ionic compound that could be formed from these elements. What is the formula of the ionic compound formed from these elements?
MgCl2
CaBr2
Na2S
K2Se
During a chemistry lab, Hayden and Louis were discussing the properties of different compounds. Louis claimed, "Aluminium chloride has a giant ionic lattice of Al 3+ and Cl – ions." Meanwhile, Hagra mentioned, "Sodium chloride dissolves in water, forming hydrogen chloride and sodium hydroxide." Faith argued, "The strong covalent bonds in silicon chloride prevent it from reacting with water." Anon added, "When phosphorus(V) chloride is added to water, the resulting solution conducts electricity." Which statement is correct?
Aluminium chloride has a giant ionic lattice of Al 3+ and Cl – ions.
Sodium chloride dissolves in water, forming hydrogen chloride and sodium hydroxide.
The strong covalent bonds in silicon chloride prevent it from reacting with water.
When phosphorus(V) chloride is added to water, the resulting solution conducts electricity.
Nadia and Kiven are studying the periodic table in their chemistry class. They notice that as they move from left to right across a period, the atomic radius of the elements decreases. They wonder why this happens. Can you explain the reason behind this trend?
Increase in the number of electron shells
Increase in nuclear charge
Decrease in nuclear charge
Increase in shielding effect
In a science class, Kenneth and Grace are discussing why the ionic radius of metals decreases across Period 3 from sodium to aluminum. Kenneth believes it is because the increased nuclear charge pulls the electrons more tightly, while Grace thinks that metals lose more electrons, resulting in a larger radius. Hagra chimes in, saying that the atomic number decreases, reducing the ionic size, and Gio adds that electrons occupy higher energy levels, expanding the radius. Who is correct?
Increased nuclear charge pulls the electrons more tightly.
Metals lose more electrons, resulting in a larger radius.
The atomic number decreases, reducing the ionic size.
Electrons occupy higher energy levels, expanding the radius.
In a science class, Faith and Grace are discussing the trend in atomic radius across Period 3. Faith believes that the number of protons increases, which increases the nuclear charge and pulls electrons closer. Grace thinks that electrons in the outer shell experience increased repulsion, which increases atomic size. Who is correct?
Electrons in the outer shell experience increased repulsion, increasing atomic size.
The number of electron shells increases, causing greater shielding.
The number of protons increases, increasing the nuclear charge and pulling electrons closer.
Atomic radius remains constant due to balanced nuclear and electron forces.
During a science experiment, Gio and Spring were discussing why silicon has a much higher melting point than sodium. Spring suggested that sodium forms a molecular structure with weak van der Waals forces, while Gio argued that silicon has a giant covalent structure requiring a large amount of energy to break bonds. Kiven chimed in, saying that silicon forms a metallic lattice with delocalized electrons, and Grace pointed out that sodium has a smaller atomic mass than silicon. Who is correct?
Sodium forms a molecular structure with weak van der Waals forces.
Silicon has a giant covalent structure requiring a large amount of energy to break bonds.
Silicon forms a metallic lattice with delocalized electrons.
Sodium has a smaller atomic mass than silicon.
During a science experiment, Gil and Madeline were tasked with identifying which oxide reacts with water to form a strongly basic solution. They had four options to consider:
SiO2
SO2
Na2O
P4O10
During a science experiment, Chelsea and Kenneth are trying to understand the reaction between magnesium and oxygen. They hypothesize that the correct equation for this reaction is essential for their experiment's success. Which equation correctly represents the reaction between magnesium and oxygen?
Mg(s) + O2(g) → MgO(s)
2Mg(s) + O2(g) → 2MgO(s)
Mg(s) + O2(g) → Mg2O(s)
2Mg(s) + O2(g) → MgO2(s)
During a chemistry experiment, Bryant and Gio were discussing the oxidation states of various compounds. They came across sulfur trioxide (SO3) and wondered what the oxidation state of sulfur in this compound is. Can you help them figure it out?
+2
+4
+6
-2
During a science experiment, Hagra and Richelle were discussing different hydroxides. Hagra mentioned that some hydroxides can react with both acids and bases. Richelle asked, 'Which hydroxide is amphoteric?'
NaOH
Mg(OH)2
Al(OH)3
P(OH)5
During a chemistry experiment, Audrey and Kenzo were tasked with comparing the behavior of SiCl4 and MgCl2 when dissolved in water. They noticed a significant difference in how these two compounds interacted with the water. The difference in their behavior is mainly due to:
Differences in the size of their ions.
Differences in the electronegativity of Si and Mg.
The presence of covalent bonds in SiCl4 and ionic bonds in MgCl2.
Differences in their boiling points.
Winston and Abi are conducting an experiment in the lab where they need to combine phosphorus and oxygen to create phosphorus pentoxide. Which equation should they use to represent this reaction?
P(s) + O2(g) → P2O3(s)
P4(s) + 3O2(g) → P2O3(s)
P4(s) + 5O2(g) → P4O10(s)
P4O10(s) + O2(g) → P4O11(s)
During a science project, Grace and Kenzo are studying the properties of elements in Period 3 of the periodic table. They observe various trends in atomic radius and melting points. Which of the following trends do they identify?
Atomic radius increases, and electrical conductivity decreases.
Atomic radius decreases, and melting point increases up to silicon and then decreases.
Ionic radius increases, and electrical conductivity remains constant.
Melting point decreases steadily, and atomic radius remains constant.
During a science experiment, Hayden discovered that aluminum can react with both vinegar (an acid) and baking soda (a base). Why is aluminum considered amphoteric?
It is a metal with a high melting point.
It reacts with both acids and bases.
It has a giant metallic structure.
It forms a protective oxide layer.
During a science experiment, Kath and Spring observed what happens when sodium reacts with water. They noticed that sodium floats, fizzes, and produces hydrogen gas and sodium hydroxide.
Sodium sinks and forms sodium oxide.
Sodium floats, fizzes, and produces hydrogen gas and sodium hydroxide.
Sodium dissolves without any visible reaction.
Sodium reacts to form sodium chloride and hydrogen gas.
Kiven and Faith are discussing why argon has a much lower boiling point than chlorine in Period 3. Kiven thinks it has to do with their atomic sizes, while Faith believes it relates to their electronegativity. Kenneth joins in, suggesting that the difference might be due to their states of matter. Richelle, however, points out that argon is a monatomic gas, while chlorine forms diatomic molecules with stronger van der Waals forces. Who is correct?
Kiven thinks argon has a larger atomic radius than chlorine.
Faith believes argon has a higher electronegativity than chlorine.
Kenneth suggests argon is nonmetallic, while chlorine is metallic.
Richelle points out that argon is a monatomic gas, while chlorine forms diatomic molecules with stronger van der Waals forces.
During a chemistry experiment, Faith and Winston were tasked with identifying which Period 3 chloride reacts with water to form a very acidic solution. They had the following options to consider:
NaCl
MgCl2
AlCl3
SiCl4
Oli and Bryant are experimenting with different metals in their school lab. They notice that as they move from sodium to aluminum in Period 3, the melting points of these metals decrease. Which trend explains this observation?
Decreasing atomic mass
Increasing nuclear charge
Increasing strength of metallic bonding
Decreasing atomic radius
During a science experiment, Bryant noticed that magnesium metal conducted electricity while sulfur did not. Why does magnesium conduct electricity while sulfur does not?
Magnesium has delocalized electrons, while sulfur forms covalent bonds.
Magnesium has a higher melting point than sulfur.
Magnesium forms ionic bonds, while sulfur forms metallic bonds.
Magnesium has free ions, while sulfur has fixed ions.
During a science project, Spring, Nadia, and Feli were discussing the properties of elements in Period 3. They wanted to know which element among them has the highest electronegativity. Can you help them find out?
Sodium (Na)
Silicon (Si)
Chlorine (Cl)
Argon (Ar)
Kiven and Feli are discussing why ionization energy generally increases across a period in the periodic table. Kiven thinks it’s because electrons are added to higher energy levels, increasing the distance from the nucleus. Feli believes it’s due to the nuclear charge increasing, which holds electrons more tightly. What do you think is the correct reason?
Electrons are added to higher energy levels, increasing the distance from the nucleus.
Nuclear charge increases, holding electrons more tightly.
Shielding effect increases, reducing the attraction between electrons and the nucleus.
Atomic radius increases, making electrons easier to remove.
In this question Q is used to represent a halogen atom. Louis and Faith are studying chemistry and discover that magnesium and calcium each form a compound with chlorine and a compound with bromine. They learn that one of these compounds contains: the element in Group 2 with the higher first ionisation energy and the element in Group 17 with the higher Q–Q bond energy. What is the formula of this compound?
MgCl2
MgBr2
CaCl2
CaBr2
Kiven and Madeline are conducting an experiment in their chemistry lab. They have two compounds, V and W, each containing a different Group 2 element. They add a sample of each solid to water, shake the mixtures, and measure the pH of the resulting solutions. V has a pH of 13.6 and W has a 9.4 pH value. Which of the following is the identity of V and W?
BaSO4, MgSO4
MgSO4, BaSO4
Ba(OH)2, Mg(OH)2
Mg(OH)2, Ba(OH)2
Grace is conducting an experiment with an impure sample of a Group 2 metal carbonate, MCO3. The sample, which she named X, contains 57% by mass of MCO3. The impurities in X do not react with hydrochloric acid. She weighs 7.4 g of X and reacts it with an excess of dilute hydrochloric acid. After the reaction, she finds that 0.050 mol of the Group 2 metal chloride is produced. What is the identity of the Group 2 metal?
Mg
Ca
Sr
Ba
During a chemistry lab, Gil and Grace mixed NH4Cl with NaOH in an aqueous solution. Which statement is correct?
The reaction gives rise to two different polar product molecules.
The bond angle in the nitrogen-containing species remains unchanged.
The ammonium ion acts as a base.
The oxidation state of nitrogen increases in the reaction.
When calcium is added to a beaker of cold water containing a few drops of litmus solution, (a) will be observed, which will not be observed with barium.
Faith decided to conduct an experiment by placing a piece of strontium in a bowl of cold water. What happens during this reaction?
A vigorous effervescence occurs.
Bubbles of gas form slowly on the strontium.
The strontium floats on the surface of the water and reacts quickly.
The strontium glows, and a white solid is produced.
When Gio and Kiven mix quicklime, water, and sand to create lime mortar for their construction project, they notice that the lime mortar hardens over time. They learn that aqueous hydrochloric acid reacts with both fresh and old lime mortar, but only the old lime mortar effervesces during the reaction. Which equation describes the change from fresh to old lime mortar?
CaO + CO2 → CaCO3
Ca(OH)2 + CO2 → CaCO3 + H2O
Ca(OH)2 → CaO + H2O
CaO + H2O → Ca(OH)2
During a chemistry experiment, Hayden discovered that the thermal decomposition of compound S releases carbon dioxide gas and forms a white solid, T. Both S and T are not soluble in water. Kenneth noted that compound T is used as a refractory kiln lining. What is compound S? Compound S is (a) .
MgO
CaO
During a science experiment, students Oli and Hillary are testing different oxides to see which one produces a saturated solution when added to water. They have BaO, CaO, MgO, and SrO to choose from. Which oxide will produce a saturated solution?
Nadia is conducting an experiment in her chemistry lab and comes across a metal labeled as Y. She needs to identify it for her project. A colourless solution was formed when metal Y was reacted with water. This solution then gave a white precipitate when mixed with aqueous sulfuric acid. What is metal Y?
Potassium
Magnesium
Barium
Sodium
In a chemistry lab, Hagra, Faith, and Anon are experimenting with different metal oxides. They discover that BaO, CaO, MgO, and SrO all produce alkaline solutions when added to water. They want to find out which oxide produces a saturated solution with the highest pH.
BaO (aq)
CaO (aq)
MgO (aq)
SrO (aq)
During a science project, Feli, Nadia, and Hayden are studying the halogens, which exist as diatomic molecules, X2. They notice that as they move down Group 17 from chlorine to iodine, the boiling points of the elements increase. Which statement explains this trend?
Of the permanent dipole in the X2 molecule increases as the group is descended.
The X-X bond strength increases as the group is descended.
The electronegativity of X decreases as the group is descended.
The number of electrons in each X2 molecule increases as the group is descended.
During a chemistry experiment, Gio and Winston decided to bubble iodine through a solution of potassium bromide. What happens as a result of this reaction?
Iodine is oxidised to iodide ions.
Potassium bromide is reduced to bromine.
Bromide ions are oxidised to bromine.
No reaction occurs.
During a chemistry lab experiment, Spring and Reyner mixed solid sodium bromide with concentrated sulfuric acid. What are the correct observations they noted during the reaction?
White fumes
Yellow solid produced
Reddish-brown gas and pungent odour
Reddish brown gas and yellow solid produced
During a science experiment, Kiven and Audrey mixed chlorine gas with cold sodium hydroxide solution. The following reaction occurred: Cl2(aq) + 2NaOH(aq) → NaCl (aq) + NaCIO (aq) + H2O (I). Which of the following statements is correct?
The chlorine has only been oxidised
The chlorine is simultaneously oxidised and reduced
The oxidation number of Cl in NaCIO is 0
The oxidation number of Cl in Cl2 is -1
Tiffany is studying the properties of Group 7 elements in her chemistry class. She comes across several statements about these elements and needs to identify which one is not correct.
Fluorine is the weakest reducing agent in Group 7.
The bond dissociation energy of the hydrogen halides from HCI to Hl increases.
Astatine has a lower first ionisation energy than iodine.
CH3l would produce a silver halide precipitate with acidified AgNO3 faster than CH3Cl or CH3Br.
During a chemistry experiment, Grace and Louis are bubbling chlorine gas through an aqueous sodium hydroxide solution. They notice that different substances are formed depending on the conditions. Which statement is incorrect?
In hot NaOH (aq), CIO3 (aq) ions are formed.
In cold NaOH (aq), CIO-(aq) ions are formed.
The oxidation state of chlorine changes from 0 to +3
Disproportionation of chlorine occurs in both cold and hot aqueous solutions.
The following report appeared in a newspaper: Barrels of bromine broke open after a vehicle collision on the motorway. Traffic was diverted as purple gaseous bromine drifted over the surface of the road (as bromine is more dense than air), causing irritation to drivers' eyes. Firemen sprayed water over the scene of the accident, dissolving the bromine and washing it away. Which of the following observations is incorrect in the report?
Bromine is not purple
Bromine does not vaporise readily
Bromine is not denser than air
Bromine does not dissolve in water
During a science experiment, Kiven and Gil were tasked with purifying water for their project. They added chlorine gas to the water. What is the main disinfectant formed during this process?
HCIO
HCI
IO2
CHCI3
During a science experiment, Grace observed that hydrogen iodide breaks down more quickly than hydrogen chloride when heated. Which statements do not explain this faster rate?
The breakdown of HCI is more exothermic than that of HI
The reaction of the breakdown of HI has smaller activation energy than that of HCI
The HCI bond is stronger than the HI bond
The HI bond is longer than the HCI bond
Compound Z has the molecular formula C4H8O2. One day, Spring and Oli were conducting an experiment in the lab where compound Z reacts with propan-1-ol in the presence of concentrated H2SO4. The diagram shows the skeletal formulae of three compounds, S, T, and U. What are the possible skeletal formulae of the products of the reaction between compound Z and propan-1-ol?
S and T
U only
S and U
T only
Match the following functions of light in chemical reactions with their corresponding effects.
to break the C–H bonds in methane
to initiate the reaction by providing energy
to break the chlorine molecules into ions
to facilitate the dissociation of molecules
to break the chlorine molecules into atoms
to promote the formation of reactive species
to heat the mixture
to increase the temperature of the reactants
Kenzo is studying the structure of molecule Q in his chemistry class. He wonders how many of the carbon atoms in molecule Q are sp2 hybridized. Can you help his figure it out?
3
4
7
10
Spring and Louis are working on a chemistry project where they need to determine how many stereoisomers can be formed from a specific structural formula. How many stereoisomers are there with this structural formula
CH3(CH2)17CH=CH(CH2)17CH(OH)CH(CH3)CO2H
2
4
6
8
Richelle is conducting an experiment in her chemistry lab and is studying structural isomerism. She needs to determine how many straight-chain isomers are there with the molecular formula C4H8Cl2. Can you help her with this?
6
7
8
9
In a chemistry lab, Feli is conducting an experiment with various chemical reactions. She learns about nucleophiles and their behavior. What is true of every nucleophile?
It attacks a double bond.
It donates a lone pair of electrons.
It is a single atom.
It is negatively charged.
Gio is conducting an experiment in the lab and needs to know the molecular formula of citric acid. It is (a) .
C6H4O7
C8H8O7
C10H8O7
Which alkene shows geometric isomerism?
In addition to those chiral centres marked by an asterisk (*), how many other chiral centres are present in the cortisone molecule?
0
1
2
3
What is the empirical formula of hexamine?
CH2N
C3H6N2
C4H8N4
C6H12N4
Which compound is the least likely to be produced in the reaction of C17H36?
C3H8
C4H8
C8H16
C16H34
How many σ and π bonds are in the molecule HCCCH2CH2CHC(CH3)2?
17 σ 3 π
17 σ 5 π
18 σ 4 π
19 σ 3 π
How many chiral carbon atoms are present in a molecule of aspartame?
1
2
3
4
Which list contains a compound that is not made during the free radical substitution of methane with chlorine?
Which equation represents a reaction that proceeds through initiation, propagation and termination steps?
Which compound has the molecular formula C6H10O?
How many different structural isomers are there for n = 3 and n = 4?
Compound X, C5H10O3, has one chiral carbon atom per molecule. Compound X produces bubbles with Na but not with Na2CO3. Which formula could represent compound X?
During a chemistry lab experiment, Louis is trying to determine the oxidation state of sulfur in the compound H2SO3. Can you help him figure it out?
+2
+4
+6
-2
Gilly is studying the properties of elements in his chemistry class. He learns about ionization energy and wonders what trend is observed in ionization energy down a group of the periodic table.
It increases.
It decreases.
It fluctuates.
It remains constant.
Richelle is studying the properties of metals in her chemistry class. She learns that as she moves down Group 1 of the periodic table, the melting point of the metals decreases. Why does this happen?
Decreasing nuclear charge
Increasing electron shells
Weakening metallic bonds
Decreasing ionic size
During a chemistry experiment, Kenneth observed that the product of burning sulfur in oxygen is (a) .
SO
SO3
S2O3
Anniver and Dimas are conducting an experiment in their chemistry class. They are trying to determine which element has the highest electronegativity. They have the following elements to choose from:
Oxygen
Fluorine
Chlorine
Nitrogen
During a chemistry experiment, Audrey added chlorine gas to a beaker of water. What is the product of this reaction?
HCl and HClO
H2 and HClO
Cl2O and H2
HCl and Cl2O
During a chemistry experiment, Hagra discovered that aluminum can react with different substances. He wondered why aluminum is considered amphoteric.
It is a metal with a high melting point.
It reacts with both acids and bases.
It has a giant metallic structure.
It forms a protective oxide layer.
Katherine is conducting an experiment in her chemistry lab where she adds phosphorus pentachloride to a beaker of water. What type of reaction occurs in this scenario?
Neutralization
Hydrolysis
Precipitation
Oxidation
Match the following reasons with their corresponding explanations for why sulfur dioxide acts as a reducing agent.
It donates electrons.
It can lose electrons in a reaction.
It has a low boiling point.
It has a lower temperature threshold for phase change.
It absorbs UV light.
It can interact with UV radiation.
It forms strong acids.
It can produce acidic solutions when dissolved in water.
When magnesium reacts with steam, (a) is formed.
Kiven is conducting an experiment in the lab. He wants to know which reaction forms magnesium oxide.
Mg(s) + O2(g) → MgO(s)
Mg(s) + H2O(l) → MgO(s) + H2(g)
Mg(s) + O2(g) → MgO2(s)
Mg(s) + CO2(g) → MgO(s) + C(s)
Mady is conducting an experiment to observe the trend in electrical conductivity across Period 3 of the periodic table. What trend does she find?
It increases consistently.
It decreases consistently.
It increases, peaks at aluminum, and then decreases.
It remains constant.
During a science experiment, Kenzo and Nadia were discussing why silicon has the highest melting point among Period 3 elements. What did they conclude?
Strong metallic bonds
Covalent macromolecular structure
Ionic bonding
Weak Van der Waals forces
During a chemistry class, Feli and Audrey are investigating the properties of halogens. They learn that as they move from fluorine to iodine, the reactivity of the elements decreases. Which statement best explains this trend?
The bond length decreases, making the bonds stronger.
The atomic size increases, making it harder to gain an electron.
The number of electron shells decreases, increasing reactivity.
The electronegativity increases, attracting electrons more strongly.
In a lab experiment, Winston and Spring are studying the solubility of different salts in water. They find that barium sulfate is insoluble while sodium sulfate is soluble. Which statement correctly explains this difference?
Sodium ions have a higher charge than barium ions, increasing solubility.
Water molecules interact more strongly with barium ions than sodium ions.
The lattice energy of barium sulfate is greater than that of sodium sulfate.
Barium ions are larger than sodium ions, affecting solubility.
During a chemistry project, Anyah and Anniver are comparing the thermal stability of different metal carbonates. They hypothesize that as they move down Group 2, the thermal stability of the carbonates increases. Which statement supports this hypothesis?
The charge of the metal ions increases, strengthening the bonds.
The lattice energy decreases, making them less stable.
The ionic radius of the metal ions increases, weakening the bonds.
The size of the carbonate ion decreases, increasing stability.
During a chemistry project, Oliver and Louis are investigating the properties of acids and bases. They learn that when hydrochloric acid reacts with sodium bicarbonate, a gas is produced. What is the name of this gas?
Hydrogen
Carbon dioxide
Oxygen
Nitrogen
