WorksheetsChemistry Spring 21' Cumulative Final Exam Review
Total questions: 112
Worksheet time: 28hrs 0mins
-32.1 kJ
-31.1 kJ
-38.1 kJ
31.8 kJ
Calculate the enthalpy of reaction (ΔH).
4CO2 (g) + 6H2O (g) → 2C2H6 (g) + 7O2 (g)
ΔHfo [CO2(g)] = -393.5 kJ
ΔHfo [H2O(g)] = -241.8 kJ
ΔHfo [C2H6(g)] = -84.7 kJ
ΔHfo [O2(g)] = 0 kJ
550.6 kJ/mol
2855.4 kJ/mol
-550.6 kJ/mol
-3194.2 kJ/mol
The specific heat of water is 4.18 J/g°C.
If 980. J of energy is added to 6.20 g of water at 18.0 °C, what is the final temperature of the water?
37.8 °C
-19.8 °C
19.8 °C
55.8 °C
The standard enthalpy of reaction (ΔH) for the reaction below is -65.2 kJ.
Determine the enthalpy of formation for Calcium Hydroxide (Ca(OH)2 (s)
CaO(s) + H2O (l) → Ca(OH)2(s)
ΔHfo [CaO(s)] = -635.6 kJ
ΔHfo [H2O(l)] = -285.8 kJ
-966.6 kJ
-986.6 kJ
986.6 kJ
-968.6 kJ
q=m x cp x ΔT
The specific heat equation is shown above, what does cp stand for?
the heat released or absorbed by a system
specific heat of a substance
mass of a substance
change in temperature
q=m x cp x ΔT
The specific heat equation is shown above, what does q stand for?
the heat released or absorbed by a system
specific heat of a substance
mass of a substance
change in temperature
q=m x cp x ΔT
The specific heat equation is shown above, what does m stand for?
the heat released or absorbed by a system
specific heat of a substance
mass of a substance
change in temperature
q=m x cp x ΔT
The specific heat equation is shown above, what does Delta T stand for?
the heat released or absorbed by a system
specific heat of a substance
mass of a substance
change in temperature
Methane combusts with oxygen through the following reaction: CH4+2O2→CO2+2H2O
How many grams of carbon dioxide are produced when 16.0 g of methane and 48.0 g of oxygen gas combust?
Molar mass of CH4 = 16.0 g/mol
Molar mass of O2 = 32.0 g/mol
Molar mass of CO2 = 44.0 g/mol
Choose the closest approximate answer
33 grams
66 grams
64 grams
92 grams
What mass of silver nitrate will react with 5.85 grams of sodium chloride to produce 14.35 grams of silver chloride and 8.5 grams of sodium nitrate?
AgNO3(aq)+NaCl(aq)→AgCl(s)+NaNO3(aq)
Molar mass of AgNO3 = 169.87 g/mol
Molar mass of NaCl = 58.44 g/mol
Molar mass of AgCl = 143.32 g/mol
Molar mass of NaNO3= 84.99 g/mol
23.5 grams
21.2 grams
17.0 grams
14.2 grams
Lead nitrate can be decomposed by heating. What is the approximate % yield of the decomposition reaction if 7.4g Pb(NO3)2 are heated to give 4.1 g PbO?
2Pb(NO3)2 (s)→2PbO(s)+4NO2(g)+O2(g)
Molar Masses:
-Pb(NO3)2 = 331.2 g/mol
-PbO = 223.2 g/mol
82%
44%
56%
67%
2NaClO3 (s) → 2NaCl (s) + 3O2 (g)
12.00 moles of NaClO3 will produce approximately how many grams of O2?
Molar Masses:
NaClO3 = 106.44 g/mol ; O2 = 32.00 g/mol
256 g of O2
576 g of O2
288 g of O2
384 g of O2
What is correct equation that should be used to determine how many formula units there are in 0.75 moles of (NH4)3PO4?
How many moles of water can be produced if 8 moles H2 are used?
Cl2 + 2KBr → Br2 + 2KCl
Approximately how many grams of potassium chloride (KCl) can be produced from 356 g of potassium bromide (KBr)?
Molar Masses:
KCl = 74.55 g/mol ; KBr = 119.00 g/mol
749 g
223 g
479 g
814 g
What is the molar mass of NaOH?
40.00 g/mol
38.99 g/mol
23.99 g/mol
57.00 g/mol
Mg + 2HCl --> MgCl2 + H2
How many moles are in 8.30 X 1023 molecules of H2O?
1.38 X 1023 moles H2O
1.38 moles H2O
2 moles H2O
1 mole H2O
What is the density of ammonia gas (NH3) in g/L at 0.913 atm and 20° C?
*Choose the closest answer*
*molar mass ammonia= 17.031 g/mol*
64.7 L
.647 g
.647 g/L
6.47 g/L
2CO + O2 −-> 2CO2
How many liters of carbon monoxide at 25.0oC and 8.56 mmHg are needed to react with 12.30 L of oxygen gas at STP?
*Molar mass oxygen gas= 32 g/mol
molar mass carbon monoxide= 28.01 g/mol*
3.14 L
318 L
2390 L
200 L
4NH3+6NO --> 5N2 + 6H2O
How many liters of NH3 at 32.6 oC and 4.25 kPa are needed to react completely with 30.0L of NO at STP?
*Choose the closest answer*
*Molar mass nitric oxide= 30.01 g/mol
molar mass ammonia= 17.031 g/mol*
5.27 L
534 L
5.2 L
533.6 L
In the equation PV = nRT, what value of R must be used if the pressure is in atm?
0.08206
62.4
22.4
6.02 X 1023
In the equation PV = nRT, what value of R must be used if the pressure is in mm Hg?
0.08206
62.36
22.4
6.02 X 1023
In the equation PV = nRT, what value of R must be used if the pressure is in kPa?
0.08206
62.36
8.314
6.022 X 1023
Which of the following shows the correct Temperature and Pressure values for a gas at STP?
P= 1.00 atm; T= 273K or 0.00⁰ C
P= 1.00 mmHg; T= 273K or 0.00⁰ C
P= 1.00 kPa; T= 273K or 0.00⁰ C
P= 1.00 atm; T= 273 ⁰ C
PV=nRT
Mg3N2 + 3H2O ––> 3 MgO + 2NH3
If 10.3 g of magnesium nitride is used, what volume of ammonia gas would be collected at 20˚C and 0.989 atm?
*Molar mass magnesium nitride= 100.95 g/mol
molar mass ammonia= 17.031 g/mol*
6.94 L NH3
4.96 L NH3
4.96 g NH3
4.96 atm NH3
In a solution, the substance that is dissolved is called the _________________.
colloid
solute
solvent
suspnsion
The process by which the positive and negative ions of an ionic solid become surrounded by solvent molecules is called _________________
solvation
dissolving
plucking
pulling
____________________________ is the concentration of a solution expressed as the number of moles of solute dissolved in each liter of solution.
molality
% by mass
molarity
mole fraction
A _______________ solution contains as much solute as can possibly be dissolved under existing conditions of temperature and pressure.
supersaturated
saturated
unsaturated
Chick - Fil -A
The solubility graph below shows the amounts of four substances that will dissolve in 100 grams of water at various water temperatures.
Which substance has 80 grams of solute dissolved in 100 grams of water at 50 C?
Potassium Bromide
Ammonium Chloride
Potassium Chloride
Lithium Hydroxide
When 50 grams of potassium chloride, KCl, is dissolved in 100 grams of water at 50 ºC, the solution can be correctly described as:
supersaturated
unsaturated
saturated
Not a solution at all
A solution of potassium chlorate, KClO3, has 20 grams of salt dissolved in 100 grams of water at 70 ºC. Approximately how many more grams of salt can be added until the solution becomes saturated?
10 grams
30 grams
80 grams
60 grams
A solution with a total volume of 1000 ml has 2.0 moles of solute dissolved in it. What is the molarity of the solution?
2.0 M
0.002 M
2000 M
500 M
What is the molarity of a solution containing 40 g NaCl in 2.0 liters of solution?
0.34 M
20 M
0.05 M
80 M
A 0.500 M solution of formic acid is prepared, and its pH is measured to be 2.04. Determine the Ka for formic acid.
Ka = [H+][HCOO-]/[HCOOH]
*Equilibrium values: [HCOOH]=0.491; [H+]/[HCOO-]=9.12 x10^-3*
9.12 x 10 -3
9.12 x 10 3
1.7 x 10 -4
1.7 x 104
A solution contains 0.04 M of a weak acid. Calculate the pH of the solution knowing that the Ka for the acid is 1.6 x 10-7
It is not possible to solve if the identity of the acid is not known
4.1
4.9
Because the Ka is very small, the pH is close to neutral (about 6)
What is the pOH of a solution with [H+] = 1.24 x 10 -2?
1.91
1.61
12.09
12.39
Which is the correct formula for writing an base ionization constant expression for the following equation involving ammonia:
NH3 + H2O →NH4+ (aq) + OH-(aq)
Kb=[NH3][NH4]
Kb=[NH3][NH4+][OH−]
Kb=[NH4][NH3+][OH−]
Kb=[NH4+][OH−][NH3]
Which is the correct Acid Ionization constant expression for the following reaction involving Hydrofluoric Acid:
HF----> H+ + F-
Ka=[HF][H+][F−]
Ka=[HF][H+][A−]
Ka=[HF][F+][H−]
Ka=[H+][F−][HF]
A solution of KOH is 2.5 x 10-5 M. What is the [H+] concentration? (Hint: Find pOH, then pH, then [H+].)
4.60
9.40
3.98 x 10-10
1.0 x 10-4.60
If a solution has a pOH of 3.7 the [OH-] of the solution is
5.0 x 10-11
2.0 x 10-4
10.3
14
If [OH-] = 1 x 10-4 M, what is the pH of the solution?
-4
10
4
-10
The [OH-] concentration of a solution = 3.0 × 10−5 M; calculate [H+] and determine if the solution is acidic or basic.
*Use Kw = 1.0 x10-14 *
[H+] = 3.3 x 10 10 ; the solution is basic
[H+] = 3.3 x 10 -10 ; the solution is acidic
[H+] = 3.3 x 10 -10 ; the solution is basic
[H+] = 3.3 x 10 10 ; the solution is acidic
0.750 M solution of the weak base ethylamine (C2H5NH2) has a pOH of 1.69, what is Kb?
Kb = [C2H5NH3+][OH-]/[C2H5NH2]
*Equilibrium values: [C2H5NH2]=0.730; [C2H5NH3+]/[OH-]=2.04 x 10^-4*
5.7 x 10 -4
5.7 x 10 4
4.16 x 10-4
4.16 x 10 4
What is the pH of a 0.053 M solution of potassium hydroxide
6.91
12.72
7.33
1.28
A certain solution has a pH of 1.93. Calculate its [H+] and [OH−].
[H+] = 1.2 x 10 -2 M ; [OH−] = 8.3 x 10 -13 M
[H+] = 1.2 x 10 2 M ; [OH−] = 8.3 x 10 13 M
[H+] = 8.3 x 10 13 M ; [OH−] = 1.2 x 10 2 M
[H+] = 8.3 x 10 -13 M ; [OH−] = 1.2 x 10 -2 M
What is the [OH-] of a solution whose pH = 5.43 ?
*Kw = [H+][OH-] or 1.0 x 10-14*
8.57
2.69 x 10-9 M
3.72 x 10-6 M
269153
What is the equation for calculating pH?
pH = [H+]
pH = log [H+]
pH = -log[OH-]
pH = -log [H+]
What is the [OH-] if the pH is 4.9?
4.9 x 10-10 M
1.0 x 10-4 M
1.25 x 10-5 M
7.94 x 10-10 M
What is the [OH-] if the [H+] is 1.0 x 10-3M?
1.0 x 10-3 M
1.0 x 10-14 M
6.02 x 10-23 M
1.0 x 10-11 M
If the [OH-] of a solution is 2.7 x 10-4 M, the pOH of the solution is
10.44
1.00
3.57
-4.43
If the pH of a solution is 4.0, what is the pOH?
4.0
10.0
1.0 x 10 -4
cannot be determined from the information
Sodium hydroxide (NaOH) is a strong base. Find the pH of a solution prepared by dissolving 1.0 g of NaOH into enough water to make 1.0 L of solution.
*The molar mass of NaOH = 40.00 g/mol; Kw = [H+][OH-] or 1.0 x 10-14 ; Molarity = mol solute / L of Solution*
124.0
12.40
1.240
14
If a solution has a [H+] of 9.3x10-11, what is the pH?
10.0
4.0
3.5
8.2
Hydrochloric acid (HCl) is a strong acid, meaning that it is essentially 100% ionized in solution. What are the values of [H+] and [OH−] in a 2.0 × 10−3 M solution of HCl?
*use Kw = 1.0 × 10−14 *
[H+]= 2.0 × 10−3 M; [OH−]=5.0 × 10−12 M
[H+]= 2.0 × 103 M; [OH−]=5.0 × 10−12 M
[H+]= 2.0 × 10-3 M; [OH−]=5.0 × 1012 M
[H+]=5.0 × 10−12 M ; [OH−]= 2.0 × 10−3 M
The Kw at room temperature (25 degrees C) is equal to 1.0 x 10-14. It can also be defined as:
the pH and pOH of a solution
the product of the hydronium ion and the hydroxide ion concentrations
-log [hydronium ion]
antilog -pH
What is the concentration of H+ in a solution with a pH of 3?
1.0 x 10-3
3.0 M
10.3 M
103 M
Which of the following is the hydrogen ion concentration of an acid?
9.2 x 10-14
2.4 x 10-7
1.0 x 10-8
5.7 x 10-11
Which of the following is the [H+] concentration of a base?
9.2 x 10-3
8.3 x 10-6
3.4 x 10-9
1.7 x 10-7
The pH of a solution is 8.43. What is the hydroxide ion OH- concentration?
3.7 x 10-9 M
2.7 x 10-6 M
antilog (-pH)
1.0 x 10-14/-pH
The [H+] concentration of a solution = 4.0 × 10−8 M; calculate [OH-] and determine if the solution is acid or basic.
*Use Kw = 1.0 x10-14 *
[OH-] = 2.5 x 10 14 ; the solution is basic
[OH-] = 2.5 x 10 -7 ; the solution is acidic
[OH-] = 2.5 x 10 -7 ; the solution is basic
[OH-] = 2.5 x 10 -14 ; the solution is acidic
What is the concentration of hydroxide ions in a 2.0 M HCl solution?
5.0 E-15 M OH-
2.0 M OH-
2.0/1.0 E-14 M OH-
antilog (-2.0)
NaOH is:
an Arrhenius base
an Arrhenius acid
neither an acid nor a base
both an acid and a base
CH3NH2 + H2O --> CH3NH3+ + OH-
CH3NH2 can be classified as which of the following? (HINT...follow the H+!!!)
The Acid-Base classification system that defined a __________ is any compound that can donate a proton (an H+ ion) to an appropriate acceptor. A _________ is a compound that can remove (or accept) a proton.
Bronsted-Lowry acid; Bronsted-Lowry Base
Arrhenius acid; Arrhenius-base
Lewis acid; Lewis Base
Monoprotic and Polyprotic Acids
The Acid-Base classification system that defined any chemical species that accepts a pair of electrons as a _______, and a _________ is a chemical species that donates a pair of electrons.
Bronsted-Lowry Acid; Bronsted-Lowry Base
Arrhenius acid; Arrhenius base
Lewis acid; Lewis base
Monoprotic and Polyprotic Acids
The Acid-Base classification system that defined acids as those that release H+ and bases as release OH- is known as ________.
Bronsted-Lowry
Arrhenius acid-base
Lewis acid-base
Monoprotic and Polyprotic Acids
In fission, a neutron is often used to start the reaction and it is also a product of the reaction. This is called a ____
neutron emission
nuclear fusion
domino effect
chain reaction

94Be + 11H → _____ + 42He
7534Se + 0-1e --> 7533As
146C --> 0-1e + ________
Complete the nuclear reaction
42He
0-1 e
00γ
178O
What does it mean when an element is radioactive?
atom emits radiation
nuclei are unstable due to uneven proton to neutron ratio
nuclei changes to become stable
all of the above
In the symbol 167N what the 7 stand for?
Mass number
Atomic number
Atomic mass
Number of neutrons
